About 2-methylpropanedinitrile
2-methylpropanedinitrile (PubChem CID 19425) has the molecular formula C4H4N2
and a molecular weight of 80.09 g/mol. Its IUPAC name is 2-methylpropanedinitrile.
Molecular Properties
| Compound Name | 2-methylpropanedinitrile |
| PubChem CID | 19425 |
| Molecular Formula | C4H4N2 |
| Molecular Weight | 80.09 g/mol |
| Exact Mass | 80.04 |
| IUPAC Name | 2-methylpropanedinitrile |
| SMILES | CC(C#N)C#N |
| InChI | InChI=1S/C4H4N2/c1-4(2-5)3-6/h4H,1H3 |
| InChIKey | LXUTYOVUICAOGH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 80.09 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpropanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanedinitrile?
The IUPAC name of 2-methylpropanedinitrile (CID 19425) is 2-methylpropanedinitrile.
What is the SMILES notation for 2-methylpropanedinitrile?
The canonical SMILES for 2-methylpropanedinitrile is CC(C#N)C#N.
What is the InChIKey of 2-methylpropanedinitrile?
The InChIKey is LXUTYOVUICAOGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2/c1-4(2-5)3-6/h4H,1H3.
What are the key properties of 2-methylpropanedinitrile?
2-methylpropanedinitrile has a molecular weight of 80.09 g/mol, XLogP of 0.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanedinitrile is sourced from PubChem (CID 19425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).