C8H12N2 — CID 11788325
2-(3-methylbutan-2-yl)propanedinitrile (PubChem CID 11788325) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 2-(3-methylbutan-2-yl)propanedinitrile.
| Compound Name | 2-(3-methylbutan-2-yl)propanedinitrile |
|---|---|
| PubChem CID | 11788325 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 2-(3-methylbutan-2-yl)propanedinitrile |
| SMILES | CC(C)C(C)C(C#N)C#N |
| InChI | InChI=1S/C8H12N2/c1-6(2)7(3)8(4-9)5-10/h6-8H,1-3H3 |
| InChIKey | GDNWGUHMJQFBLD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |