C17H18FN3O — CID 10171756
1-[2-(5-fluoro-2,3-dihydroindol-1-yl)ethyl]-3-phenylurea (PubChem CID 10171756) has the molecular formula C17H18FN3O and a molecular weight of 299.35 g/mol. Its IUPAC name is 1-[2-(5-fluoro-2,3-dihydroindol-1-yl)ethyl]-3-phenylurea.
| Compound Name | 1-[2-(5-fluoro-2,3-dihydroindol-1-yl)ethyl]-3-phenylurea |
|---|---|
| PubChem CID | 10171756 |
| Molecular Formula | C17H18FN3O |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-[2-(5-fluoro-2,3-dihydroindol-1-yl)ethyl]-3-phenylurea |
| SMILES | O=C(NCCN1CCc2cc(F)ccc21)Nc1ccccc1 |
| InChI | InChI=1S/C17H18FN3O/c18-14-6-7-16-13(12-14)8-10-21(16)11-9-19-17(22)20-15-4-2-1-3-5-15/h1-7,12H,8-11H2,(H2,19,20,22) |
| InChIKey | YTRNDKLMOKYMJJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |