C21H26N4O2 — CID 10172468
3-benzyl-2-[1-(1,4-diazepan-1-yl)propyl]furo[2,3-d]pyrimidin-4-one (PubChem CID 10172468) has the molecular formula C21H26N4O2 and a molecular weight of 366.46 g/mol. Its IUPAC name is 3-benzyl-2-[1-(1,4-diazepan-1-yl)propyl]furo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-benzyl-2-[1-(1,4-diazepan-1-yl)propyl]furo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 10172468 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 3-benzyl-2-[1-(1,4-diazepan-1-yl)propyl]furo[2,3-d]pyrimidin-4-one |
| SMILES | CCC(c1nc2occc2c(=O)n1Cc1ccccc1)N1CCCNCC1 |
| InChI | InChI=1S/C21H26N4O2/c1-2-18(24-12-6-10-22-11-13-24)19-23-20-17(9-14-27-20)21(26)25(19)15-16-7-4-3-5-8-16/h3-5,7-9,14,18,22H,2,6,10-13,15H2,1H3 |
| InChIKey | WGRWPEUXJBXHNV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |