C22H27BrN2O5 — CID 1017387
4-[[3-bromo-4-[2-(tert-butylamino)-2-oxoethoxy]-5-ethoxyphenyl]methylamino]benzoic acid (PubChem CID 1017387) has the molecular formula C22H27BrN2O5 and a molecular weight of 479.37 g/mol. Its IUPAC name is 4-[[3-bromo-4-[2-(tert-butylamino)-2-oxoethoxy]-5-ethoxyphenyl]methylamino]benzoic acid.
| Compound Name | 4-[[3-bromo-4-[2-(tert-butylamino)-2-oxoethoxy]-5-ethoxyphenyl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 1017387 |
| Molecular Formula | C22H27BrN2O5 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 4-[[3-bromo-4-[2-(tert-butylamino)-2-oxoethoxy]-5-ethoxyphenyl]methylamino]benzoic acid |
| SMILES | CCOc1cc(CNc2ccc(C(=O)O)cc2)cc(Br)c1OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C22H27BrN2O5/c1-5-29-18-11-14(12-24-16-8-6-15(7-9-16)21(27)28)10-17(23)20(18)30-13-19(26)25-22(2,3)4/h6-11,24H,5,12-13H2,1-4H3,(H,25,26)(H,27,28) |
| InChIKey | NOFWZMXVFGCSOQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |