C14H13IN2O — CID 1017624
N-(5-iodo-6-methyl-2-pyridinyl)-2-phenylacetamide (PubChem CID 1017624) has the molecular formula C14H13IN2O and a molecular weight of 352.18 g/mol. Its IUPAC name is N-(5-iodo-6-methyl-2-pyridinyl)-2-phenylacetamide.
| Compound Name | N-(5-iodo-6-methyl-2-pyridinyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 1017624 |
| Molecular Formula | C14H13IN2O |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | N-(5-iodo-6-methyl-2-pyridinyl)-2-phenylacetamide |
| SMILES | Cc1nc(NC(=O)Cc2ccccc2)ccc1I |
| InChI | InChI=1S/C14H13IN2O/c1-10-12(15)7-8-13(16-10)17-14(18)9-11-5-3-2-4-6-11/h2-8H,9H2,1H3,(H,16,17,18) |
| InChIKey | QFFQKEJWFNAUEB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|