C8H9IN2O2 — CID 150133379
(6-ethyl-5-iodo-2-pyridinyl)carbamic acid (PubChem CID 150133379) has the molecular formula C8H9IN2O2 and a molecular weight of 292.08 g/mol. Its IUPAC name is (6-ethyl-5-iodo-2-pyridinyl)carbamic acid.
| Compound Name | (6-ethyl-5-iodo-2-pyridinyl)carbamic acid |
|---|---|
| PubChem CID | 150133379 |
| Molecular Formula | C8H9IN2O2 |
| Molecular Weight | 292.08 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | (6-ethyl-5-iodo-2-pyridinyl)carbamic acid |
| SMILES | CCc1nc(NC(=O)O)ccc1I |
| InChI | InChI=1S/C8H9IN2O2/c1-2-6-5(9)3-4-7(10-6)11-8(12)13/h3-4H,2H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | FBSKMVDHEGTLKC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.08 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|