C16H17IN2O2 — CID 19630585
2-(3,5-dimethylphenoxy)-N-(5-iodo-6-methyl-2-pyridinyl)acetamide (PubChem CID 19630585) has the molecular formula C16H17IN2O2 and a molecular weight of 396.23 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-N-(5-iodo-6-methyl-2-pyridinyl)acetamide.
| Compound Name | 2-(3,5-dimethylphenoxy)-N-(5-iodo-6-methyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 19630585 |
| Molecular Formula | C16H17IN2O2 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-N-(5-iodo-6-methyl-2-pyridinyl)acetamide |
| SMILES | Cc1cc(C)cc(OCC(=O)Nc2ccc(I)c(C)n2)c1 |
| InChI | InChI=1S/C16H17IN2O2/c1-10-6-11(2)8-13(7-10)21-9-16(20)19-15-5-4-14(17)12(3)18-15/h4-8H,9H2,1-3H3,(H,18,19,20) |
| InChIKey | FLRMGRQZFAWXTR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|