C17H18INO2 — CID 18287456
2-(3,5-dimethylphenoxy)-N-(3-iodo-4-methylphenyl)acetamide (PubChem CID 18287456) has the molecular formula C17H18INO2 and a molecular weight of 395.24 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-N-(3-iodo-4-methylphenyl)acetamide.
| Compound Name | 2-(3,5-dimethylphenoxy)-N-(3-iodo-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 18287456 |
| Molecular Formula | C17H18INO2 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-N-(3-iodo-4-methylphenyl)acetamide |
| SMILES | Cc1cc(C)cc(OCC(=O)Nc2ccc(C)c(I)c2)c1 |
| InChI | InChI=1S/C17H18INO2/c1-11-6-12(2)8-15(7-11)21-10-17(20)19-14-5-4-13(3)16(18)9-14/h4-9H,10H2,1-3H3,(H,19,20) |
| InChIKey | DRJVITQPZBTQRM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|