C18H17NO6 — CID 17359281
5-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzene-1,3-dicarboxylic acid (PubChem CID 17359281) has the molecular formula C18H17NO6 and a molecular weight of 343.34 g/mol. Its IUPAC name is 5-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 17359281 |
| Molecular Formula | C18H17NO6 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 5-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzene-1,3-dicarboxylic acid |
| SMILES | Cc1cc(C)cc(OCC(=O)Nc2cc(C(=O)O)cc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C18H17NO6/c1-10-3-11(2)5-15(4-10)25-9-16(20)19-14-7-12(17(21)22)6-13(8-14)18(23)24/h3-8H,9H2,1-2H3,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | XKOPUUZVBOZIRP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |