C16H14Cl3IN2O2 — CID 17117025
N-(5-iodo-6-methyl-2-pyridinyl)-2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetamide (PubChem CID 17117025) has the molecular formula C16H14Cl3IN2O2 and a molecular weight of 499.56 g/mol. Its IUPAC name is N-(5-iodo-6-methyl-2-pyridinyl)-2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetamide.
| Compound Name | N-(5-iodo-6-methyl-2-pyridinyl)-2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 17117025 |
| Molecular Formula | C16H14Cl3IN2O2 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 497.92 |
| IUPAC Name | N-(5-iodo-6-methyl-2-pyridinyl)-2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetamide |
| SMILES | Cc1nc(NC(=O)COc2c(Cl)c(C)c(Cl)c(C)c2Cl)ccc1I |
| InChI | InChI=1S/C16H14Cl3IN2O2/c1-7-13(17)8(2)15(19)16(14(7)18)24-6-12(23)22-11-5-4-10(20)9(3)21-11/h4-5H,6H2,1-3H3,(H,21,22,23) |
| InChIKey | OMIPFSQBKQCUCO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|