C7H7I2N — CID 165475351
2-ethyl-3,6-diiodopyridine (PubChem CID 165475351) has the molecular formula C7H7I2N and a molecular weight of 358.95 g/mol. Its IUPAC name is 2-ethyl-3,6-diiodopyridine.
| Compound Name | 2-ethyl-3,6-diiodopyridine |
|---|---|
| PubChem CID | 165475351 |
| Molecular Formula | C7H7I2N |
| Molecular Weight | 358.95 g/mol |
| Exact Mass | 358.87 |
| IUPAC Name | 2-ethyl-3,6-diiodopyridine |
| SMILES | CCc1nc(I)ccc1I |
| InChI | InChI=1S/C7H7I2N/c1-2-6-5(8)3-4-7(9)10-6/h3-4H,2H2,1H3 |
| InChIKey | PTHADIYVHKXXEF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.95 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|