C11H13IN2 — CID 70903225
5,6-diethyl-1-iodopyrrolo[2,3-b]pyridine (PubChem CID 70903225) has the molecular formula C11H13IN2 and a molecular weight of 300.14 g/mol. Its IUPAC name is 5,6-diethyl-1-iodopyrrolo[2,3-b]pyridine.
| Compound Name | 5,6-diethyl-1-iodopyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 70903225 |
| Molecular Formula | C11H13IN2 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 5,6-diethyl-1-iodopyrrolo[2,3-b]pyridine |
| SMILES | CCc1cc2ccn(I)c2nc1CC |
| InChI | InChI=1S/C11H13IN2/c1-3-8-7-9-5-6-14(12)11(9)13-10(8)4-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | YHEGCZCFPZVOJF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|