C11H16N2 — CID 156569398
2-ethenyl-5,6-diethylpyridin-3-amine (PubChem CID 156569398) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-ethenyl-5,6-diethylpyridin-3-amine.
| Compound Name | 2-ethenyl-5,6-diethylpyridin-3-amine |
|---|---|
| PubChem CID | 156569398 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-ethenyl-5,6-diethylpyridin-3-amine |
| SMILES | C=Cc1nc(CC)c(CC)cc1N |
| InChI | InChI=1S/C11H16N2/c1-4-8-7-9(12)11(6-3)13-10(8)5-2/h6-7H,3-5,12H2,1-2H3 |
| InChIKey | WEWCDPZTIWWFRJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |