C25H37N — CID 154656160
ethane;2-[1-(4-ethenylphenyl)ethenyl]-4,5-diethylaniline;propane (PubChem CID 154656160) has the molecular formula C25H37N and a molecular weight of 351.58 g/mol. Its IUPAC name is ethane;2-[1-(4-ethenylphenyl)ethenyl]-4,5-diethylaniline;propane.
| Compound Name | ethane;2-[1-(4-ethenylphenyl)ethenyl]-4,5-diethylaniline;propane |
|---|---|
| PubChem CID | 154656160 |
| Molecular Formula | C25H37N |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | ethane;2-[1-(4-ethenylphenyl)ethenyl]-4,5-diethylaniline;propane |
| SMILES | C=Cc1ccc(C(=C)c2cc(CC)c(CC)cc2N)cc1.CC.CCC |
| InChI | InChI=1S/C20H23N.C3H8.C2H6/c1-5-15-8-10-18(11-9-15)14(4)19-12-16(6-2)17(7-3)13-20(19)21;1-3-2;1-2/h5,8-13H,1,4,6-7,21H2,2-3H3;3H2,1-2H3;1-2H3 |
| InChIKey | HZIXXJRHLJMKJR-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|