C13H18O3 — CID 160975944
carbonic acid;4-ethenyl-1,2-diethylbenzene (PubChem CID 160975944) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is carbonic acid;4-ethenyl-1,2-diethylbenzene.
| Compound Name | carbonic acid;4-ethenyl-1,2-diethylbenzene |
|---|---|
| PubChem CID | 160975944 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | carbonic acid;4-ethenyl-1,2-diethylbenzene |
| SMILES | C=Cc1ccc(CC)c(CC)c1.O=C(O)O |
| InChI | InChI=1S/C12H16.CH2O3/c1-4-10-7-8-11(5-2)12(6-3)9-10;2-1(3)4/h4,7-9H,1,5-6H2,2-3H3;(H2,2,3,4) |
| InChIKey | SYWCYJGWHZDLIM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |