C24H25N3O2 — CID 10178290
cis-(1R,2S)-N-[(R)-cyano(phenyl)methyl]-2-[[(Z)-3-phenylprop-2-enoyl]amino]cyclohexane-1-carboxamide (PubChem CID 10178290) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is cis-(1R,2S)-N-[(R)-cyano(phenyl)methyl]-2-[[(Z)-3-phenylprop-2-enoyl]amino]cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-[(R)-cyano(phenyl)methyl]-2-[[(Z)-3-phenylprop-2-enoyl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 10178290 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | cis-(1R,2S)-N-[(R)-cyano(phenyl)methyl]-2-[[(Z)-3-phenylprop-2-enoyl]amino]cyclohexane-1-carboxamide |
| SMILES | N#C[C@H](NC(=O)[C@@H]1CCCC[C@@H]1NC(=O)/C=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25N3O2/c25-17-22(19-11-5-2-6-12-19)27-24(29)20-13-7-8-14-21(20)26-23(28)16-15-18-9-3-1-4-10-18/h1-6,9-12,15-16,20-22H,7-8,13-14H2,(H,26,28)(H,27,29)/b16-15-/t20-,21+,22+/m1/s1 |
| InChIKey | BZIRYAILDLIZHP-HNQXNCMESA-N |
| XLogP | 3.76 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|