C26H32N4 — CID 10179136
2,7-dimethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 10179136) has the molecular formula C26H32N4 and a molecular weight of 400.57 g/mol. Its IUPAC name is 2,7-dimethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 2,7-dimethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 10179136 |
| Molecular Formula | C26H32N4 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 2,7-dimethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | Cc1ccc2nc3c(c(Nc4ccc(N5CCN(C)CC5)cc4)c2c1)CC(C)CC3 |
| InChI | InChI=1S/C26H32N4/c1-18-4-10-24-22(16-18)26(23-17-19(2)5-11-25(23)28-24)27-20-6-8-21(9-7-20)30-14-12-29(3)13-15-30/h4,6-10,16,19H,5,11-15,17H2,1-3H3,(H,27,28) |
| InChIKey | QYNDZEYXHRVXBK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|