C24H22N2O2S — CID 10179254
7-(3-benzylindol-1-yl)sulfonyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 10179254) has the molecular formula C24H22N2O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is 7-(3-benzylindol-1-yl)sulfonyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-(3-benzylindol-1-yl)sulfonyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 10179254 |
| Molecular Formula | C24H22N2O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 7-(3-benzylindol-1-yl)sulfonyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | O=S(=O)(c1ccc2c(c1)CNCC2)n1cc(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C24H22N2O2S/c27-29(28,22-11-10-19-12-13-25-16-20(19)15-22)26-17-21(14-18-6-2-1-3-7-18)23-8-4-5-9-24(23)26/h1-11,15,17,25H,12-14,16H2 |
| InChIKey | MKVKAOSRGPMIRA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |