C27H21N3O — CID 10179306
N-[4-[[amino(phenyl)methylidene]amino]phenyl]-9H-fluorene-1-carboxamide (PubChem CID 10179306) has the molecular formula C27H21N3O and a molecular weight of 403.49 g/mol. Its IUPAC name is N-[4-[[amino(phenyl)methylidene]amino]phenyl]-9H-fluorene-1-carboxamide.
| Compound Name | N-[4-[[amino(phenyl)methylidene]amino]phenyl]-9H-fluorene-1-carboxamide |
|---|---|
| PubChem CID | 10179306 |
| Molecular Formula | C27H21N3O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-[4-[[amino(phenyl)methylidene]amino]phenyl]-9H-fluorene-1-carboxamide |
| SMILES | N/C(=N\c1ccc(NC(=O)c2cccc3c2Cc2ccccc2-3)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H21N3O/c28-26(18-7-2-1-3-8-18)29-20-13-15-21(16-14-20)30-27(31)24-12-6-11-23-22-10-5-4-9-19(22)17-25(23)24/h1-16H,17H2,(H2,28,29)(H,30,31) |
| InChIKey | BISDFHBSKYRFMP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|