C27H20FN3O — CID 139891871
N-[3-[[amino(phenyl)methylidene]amino]phenyl]-7-fluoro-9H-fluorene-1-carboxamide (PubChem CID 139891871) has the molecular formula C27H20FN3O and a molecular weight of 421.48 g/mol. Its IUPAC name is N-[3-[[amino(phenyl)methylidene]amino]phenyl]-7-fluoro-9H-fluorene-1-carboxamide.
| Compound Name | N-[3-[[amino(phenyl)methylidene]amino]phenyl]-7-fluoro-9H-fluorene-1-carboxamide |
|---|---|
| PubChem CID | 139891871 |
| Molecular Formula | C27H20FN3O |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-[3-[[amino(phenyl)methylidene]amino]phenyl]-7-fluoro-9H-fluorene-1-carboxamide |
| SMILES | N/C(=N\c1cccc(NC(=O)c2cccc3c2Cc2cc(F)ccc2-3)c1)c1ccccc1 |
| InChI | InChI=1S/C27H20FN3O/c28-19-12-13-22-18(14-19)15-25-23(22)10-5-11-24(25)27(32)31-21-9-4-8-20(16-21)30-26(29)17-6-2-1-3-7-17/h1-14,16H,15H2,(H2,29,30)(H,31,32) |
| InChIKey | SVNJTLHNYNQYGI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|