C27H22N4 — CID 11258159
2-N',7-N'-diphenyl-9H-fluorene-2,7-dicarboximidamide (PubChem CID 11258159) has the molecular formula C27H22N4 and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-N',7-N'-diphenyl-9H-fluorene-2,7-dicarboximidamide.
| Compound Name | 2-N',7-N'-diphenyl-9H-fluorene-2,7-dicarboximidamide |
|---|---|
| PubChem CID | 11258159 |
| Molecular Formula | C27H22N4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-N',7-N'-diphenyl-9H-fluorene-2,7-dicarboximidamide |
| SMILES | N/C(=N\c1ccccc1)c1ccc2c(c1)Cc1cc(/C(N)=N/c3ccccc3)ccc1-2 |
| InChI | InChI=1S/C27H22N4/c28-26(30-22-7-3-1-4-8-22)18-11-13-24-20(15-18)17-21-16-19(12-14-25(21)24)27(29)31-23-9-5-2-6-10-23/h1-16H,17H2,(H2,28,30)(H2,29,31) |
| InChIKey | AURMGRCUUSXOKG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|