C26H20N4O — CID 139891858
N-[3-[[amino(phenyl)methylidene]amino]phenyl]-9H-carbazole-1-carboxamide (PubChem CID 139891858) has the molecular formula C26H20N4O and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[3-[[amino(phenyl)methylidene]amino]phenyl]-9H-carbazole-1-carboxamide.
| Compound Name | N-[3-[[amino(phenyl)methylidene]amino]phenyl]-9H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 139891858 |
| Molecular Formula | C26H20N4O |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-[3-[[amino(phenyl)methylidene]amino]phenyl]-9H-carbazole-1-carboxamide |
| SMILES | N/C(=N\c1cccc(NC(=O)c2cccc3c2[nH]c2ccccc23)c1)c1ccccc1 |
| InChI | InChI=1S/C26H20N4O/c27-25(17-8-2-1-3-9-17)28-18-10-6-11-19(16-18)29-26(31)22-14-7-13-21-20-12-4-5-15-23(20)30-24(21)22/h1-16,30H,(H2,27,28)(H,29,31) |
| InChIKey | LXRBVMFOKKCOPR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 83.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|