C24H24N4O5 — CID 140659533
2-[N'-(3-benzamidophenyl)carbamimidoyl]-3,4,5-trimethoxybenzamide (PubChem CID 140659533) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is 2-[N'-(3-benzamidophenyl)carbamimidoyl]-3,4,5-trimethoxybenzamide.
| Compound Name | 2-[N'-(3-benzamidophenyl)carbamimidoyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 140659533 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 2-[N'-(3-benzamidophenyl)carbamimidoyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(N)=O)c(/C(N)=N/c2cccc(NC(=O)c3ccccc3)c2)c(OC)c1OC |
| InChI | InChI=1S/C24H24N4O5/c1-31-18-13-17(23(26)29)19(21(33-3)20(18)32-2)22(25)27-15-10-7-11-16(12-15)28-24(30)14-8-5-4-6-9-14/h4-13H,1-3H3,(H2,25,27)(H2,26,29)(H,28,30) |
| InChIKey | SGVDHDZCHWYREG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|