C25H24N4O4 — CID 140659546
2-[N'-(3-indol-1-ylphenyl)carbamimidoyl]-3,4,5-trimethoxybenzamide (PubChem CID 140659546) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-[N'-(3-indol-1-ylphenyl)carbamimidoyl]-3,4,5-trimethoxybenzamide.
| Compound Name | 2-[N'-(3-indol-1-ylphenyl)carbamimidoyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 140659546 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2-[N'-(3-indol-1-ylphenyl)carbamimidoyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(N)=O)c(/C(N)=N/c2cccc(-n3ccc4ccccc43)c2)c(OC)c1OC |
| InChI | InChI=1S/C25H24N4O4/c1-31-20-14-18(25(27)30)21(23(33-3)22(20)32-2)24(26)28-16-8-6-9-17(13-16)29-12-11-15-7-4-5-10-19(15)29/h4-14H,1-3H3,(H2,26,28)(H2,27,30) |
| InChIKey | HJWWHJDPZZCKEK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|