C25H25ClN4O6 — CID 140659526
2-[N'-[4-chloro-3-[(4-methoxyphenyl)carbamoyl]phenyl]carbamimidoyl]-3,4,5-trimethoxybenzamide (PubChem CID 140659526) has the molecular formula C25H25ClN4O6 and a molecular weight of 512.95 g/mol. Its IUPAC name is 2-[N'-[4-chloro-3-[(4-methoxyphenyl)carbamoyl]phenyl]carbamimidoyl]-3,4,5-trimethoxybenzamide.
| Compound Name | 2-[N'-[4-chloro-3-[(4-methoxyphenyl)carbamoyl]phenyl]carbamimidoyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 140659526 |
| Molecular Formula | C25H25ClN4O6 |
| Molecular Weight | 512.95 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 2-[N'-[4-chloro-3-[(4-methoxyphenyl)carbamoyl]phenyl]carbamimidoyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1ccc(NC(=O)c2cc(/N=C(\N)c3c(C(N)=O)cc(OC)c(OC)c3OC)ccc2Cl)cc1 |
| InChI | InChI=1S/C25H25ClN4O6/c1-33-15-8-5-13(6-9-15)30-25(32)16-11-14(7-10-18(16)26)29-23(27)20-17(24(28)31)12-19(34-2)21(35-3)22(20)36-4/h5-12H,1-4H3,(H2,27,29)(H2,28,31)(H,30,32) |
| InChIKey | AWRJDVVYXCSXAX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 147.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.95 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|