C28H23N3O8 — CID 94840217
[4-[(E)-[(3,4,5-trimethoxy-2-nitrobenzoyl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate (PubChem CID 94840217) has the molecular formula C28H23N3O8 and a molecular weight of 529.51 g/mol. Its IUPAC name is [4-[(E)-[(3,4,5-trimethoxy-2-nitrobenzoyl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate.
| Compound Name | [4-[(E)-[(3,4,5-trimethoxy-2-nitrobenzoyl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 94840217 |
| Molecular Formula | C28H23N3O8 |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | [4-[(E)-[(3,4,5-trimethoxy-2-nitrobenzoyl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
| SMILES | COc1cc(C(=O)N/N=C/c2ccc(OC(=O)c3cccc4ccccc34)cc2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C28H23N3O8/c1-36-23-15-22(24(31(34)35)26(38-3)25(23)37-2)27(32)30-29-16-17-11-13-19(14-12-17)39-28(33)21-10-6-8-18-7-4-5-9-20(18)21/h4-16H,1-3H3,(H,30,32)/b29-16+ |
| InChIKey | HDTRFEHHAHJDIQ-MUFRIFMGSA-N |
| XLogP | 4.76 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|