About 3-indol-1-ylbenzaldehyde
3-indol-1-ylbenzaldehyde (PubChem CID 175205647) has the molecular formula C15H11NO
and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-indol-1-ylbenzaldehyde.
Molecular Properties
| Compound Name | 3-indol-1-ylbenzaldehyde |
| PubChem CID | 175205647 |
| Molecular Formula | C15H11NO |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 3-indol-1-ylbenzaldehyde |
| SMILES | O=Cc1cccc(-n2ccc3ccccc32)c1 |
| InChI | InChI=1S/C15H11NO/c17-11-12-4-3-6-14(10-12)16-9-8-13-5-1-2-7-15(13)16/h1-11H |
| InChIKey | DKSJLPVXPLELDD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-indol-1-ylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-indol-1-ylbenzaldehyde?
The IUPAC name of 3-indol-1-ylbenzaldehyde (CID 175205647) is 3-indol-1-ylbenzaldehyde.
What is the SMILES notation for 3-indol-1-ylbenzaldehyde?
The canonical SMILES for 3-indol-1-ylbenzaldehyde is O=Cc1cccc(-n2ccc3ccccc32)c1.
What is the InChIKey of 3-indol-1-ylbenzaldehyde?
The InChIKey is DKSJLPVXPLELDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO/c17-11-12-4-3-6-14(10-12)16-9-8-13-5-1-2-7-15(13)16/h1-11H.
What are the key properties of 3-indol-1-ylbenzaldehyde?
3-indol-1-ylbenzaldehyde has a molecular weight of 221.26 g/mol, XLogP of 3.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-indol-1-ylbenzaldehyde is sourced from PubChem (CID 175205647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).