C17H19N3O5 — CID 87396074
2-amino-3,5,6-trimethoxy-1-N-phenylbenzene-1,4-dicarboxamide (PubChem CID 87396074) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-amino-3,5,6-trimethoxy-1-N-phenylbenzene-1,4-dicarboxamide.
| Compound Name | 2-amino-3,5,6-trimethoxy-1-N-phenylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 87396074 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-amino-3,5,6-trimethoxy-1-N-phenylbenzene-1,4-dicarboxamide |
| SMILES | COc1c(OC)c(C(N)=O)c(OC)c(N)c1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H19N3O5/c1-23-13-11(16(19)21)15(25-3)14(24-2)10(12(13)18)17(22)20-9-7-5-4-6-8-9/h4-8H,18H2,1-3H3,(H2,19,21)(H,20,22) |
| InChIKey | CPHLGSRYUBBNOK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|