C25H20N2O4 — CID 10179889
2-[2-(3-cyanoanilino)-2-oxoethyl]-4-oxo-4-(4-phenylphenyl)butanoic acid (PubChem CID 10179889) has the molecular formula C25H20N2O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-[2-(3-cyanoanilino)-2-oxoethyl]-4-oxo-4-(4-phenylphenyl)butanoic acid.
| Compound Name | 2-[2-(3-cyanoanilino)-2-oxoethyl]-4-oxo-4-(4-phenylphenyl)butanoic acid |
|---|---|
| PubChem CID | 10179889 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 2-[2-(3-cyanoanilino)-2-oxoethyl]-4-oxo-4-(4-phenylphenyl)butanoic acid |
| SMILES | N#Cc1cccc(NC(=O)CC(CC(=O)c2ccc(-c3ccccc3)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C25H20N2O4/c26-16-17-5-4-8-22(13-17)27-24(29)15-21(25(30)31)14-23(28)20-11-9-19(10-12-20)18-6-2-1-3-7-18/h1-13,21H,14-15H2,(H,27,29)(H,30,31) |
| InChIKey | RJNLJNDPVKTXBA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |