C23H17NO2 — CID 13223976
3-(1,4-dioxo-1,4-diphenylbutan-2-yl)benzonitrile (PubChem CID 13223976) has the molecular formula C23H17NO2 and a molecular weight of 339.39 g/mol. Its IUPAC name is 3-(1,4-dioxo-1,4-diphenylbutan-2-yl)benzonitrile.
| Compound Name | 3-(1,4-dioxo-1,4-diphenylbutan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 13223976 |
| Molecular Formula | C23H17NO2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 3-(1,4-dioxo-1,4-diphenylbutan-2-yl)benzonitrile |
| SMILES | N#Cc1cccc(C(CC(=O)c2ccccc2)C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H17NO2/c24-16-17-8-7-13-20(14-17)21(23(26)19-11-5-2-6-12-19)15-22(25)18-9-3-1-4-10-18/h1-14,21H,15H2 |
| InChIKey | VYAVGIZKPIHNOK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |