C17H12F3NO — CID 102107128
3-(4,4,4-trifluoro-1-oxo-1-phenylbutan-2-yl)benzonitrile (PubChem CID 102107128) has the molecular formula C17H12F3NO and a molecular weight of 303.28 g/mol. Its IUPAC name is 3-(4,4,4-trifluoro-1-oxo-1-phenylbutan-2-yl)benzonitrile.
| Compound Name | 3-(4,4,4-trifluoro-1-oxo-1-phenylbutan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 102107128 |
| Molecular Formula | C17H12F3NO |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 3-(4,4,4-trifluoro-1-oxo-1-phenylbutan-2-yl)benzonitrile |
| SMILES | N#Cc1cccc(C(CC(F)(F)F)C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H12F3NO/c18-17(19,20)10-15(14-8-4-5-12(9-14)11-21)16(22)13-6-2-1-3-7-13/h1-9,15H,10H2 |
| InChIKey | IPBPOKJCVBCABY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |