C20H24N6O5 — CID 10180967
1-[2-[(5-cyano-2-pyridinyl)amino]ethyl-[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]carbamoyl]oxyethyl acetate (PubChem CID 10180967) has the molecular formula C20H24N6O5 and a molecular weight of 428.45 g/mol. Its IUPAC name is 1-[2-[(5-cyano-2-pyridinyl)amino]ethyl-[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]carbamoyl]oxyethyl acetate.
| Compound Name | 1-[2-[(5-cyano-2-pyridinyl)amino]ethyl-[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]carbamoyl]oxyethyl acetate |
|---|---|
| PubChem CID | 10180967 |
| Molecular Formula | C20H24N6O5 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 1-[2-[(5-cyano-2-pyridinyl)amino]ethyl-[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]carbamoyl]oxyethyl acetate |
| SMILES | CC(=O)OC(C)OC(=O)N(CCNc1ccc(C#N)cn1)CC(=O)N1CCC[C@H]1C#N |
| InChI | InChI=1S/C20H24N6O5/c1-14(27)30-15(2)31-20(29)25(13-19(28)26-8-3-4-17(26)11-22)9-7-23-18-6-5-16(10-21)12-24-18/h5-6,12,15,17H,3-4,7-9,13H2,1-2H3,(H,23,24)/t15?,17-/m0/s1 |
| InChIKey | CPBGDQXSPCAMCV-LWKPJOBUSA-N |
| XLogP | 1.23 |
| TPSA | 148.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|