C15H18N6O — CID 87791280
6-[1-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethylamino]pyridine-3-carbonitrile (PubChem CID 87791280) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is 6-[1-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[1-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 87791280 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 6-[1-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethylamino]pyridine-3-carbonitrile |
| SMILES | CC(NCC(=O)N1CCCC1C#N)Nc1ccc(C#N)cn1 |
| InChI | InChI=1S/C15H18N6O/c1-11(20-14-5-4-12(7-16)9-19-14)18-10-15(22)21-6-2-3-13(21)8-17/h4-5,9,11,13,18H,2-3,6,10H2,1H3,(H,19,20) |
| InChIKey | UTSPFVASOCPLST-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 104.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|