C14H16ClN3O5S3 — CID 10181593
N-[3-[2-[(5-chlorothiophen-2-yl)methylsulfonyl]hydrazinyl]-3-oxopropyl]benzenesulfonamide (PubChem CID 10181593) has the molecular formula C14H16ClN3O5S3 and a molecular weight of 437.95 g/mol. Its IUPAC name is N-[3-[2-[(5-chlorothiophen-2-yl)methylsulfonyl]hydrazinyl]-3-oxopropyl]benzenesulfonamide.
| Compound Name | N-[3-[2-[(5-chlorothiophen-2-yl)methylsulfonyl]hydrazinyl]-3-oxopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10181593 |
| Molecular Formula | C14H16ClN3O5S3 |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 436.99 |
| IUPAC Name | N-[3-[2-[(5-chlorothiophen-2-yl)methylsulfonyl]hydrazinyl]-3-oxopropyl]benzenesulfonamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccccc1)NNS(=O)(=O)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C14H16ClN3O5S3/c15-13-7-6-11(24-13)10-25(20,21)18-17-14(19)8-9-16-26(22,23)12-4-2-1-3-5-12/h1-7,16,18H,8-10H2,(H,17,19) |
| InChIKey | OVHQIDLUCSGEGU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|