C13H13ClN2O5S3 — CID 2820374
N'-[4-(4-chlorophenyl)sulfonyl-3-methylthiophen-2-yl]sulfonylacetohydrazide (PubChem CID 2820374) has the molecular formula C13H13ClN2O5S3 and a molecular weight of 408.91 g/mol. Its IUPAC name is N'-[4-(4-chlorophenyl)sulfonyl-3-methylthiophen-2-yl]sulfonylacetohydrazide.
| Compound Name | N'-[4-(4-chlorophenyl)sulfonyl-3-methylthiophen-2-yl]sulfonylacetohydrazide |
|---|---|
| PubChem CID | 2820374 |
| Molecular Formula | C13H13ClN2O5S3 |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | N'-[4-(4-chlorophenyl)sulfonyl-3-methylthiophen-2-yl]sulfonylacetohydrazide |
| SMILES | CC(=O)NNS(=O)(=O)c1scc(S(=O)(=O)c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C13H13ClN2O5S3/c1-8-12(23(18,19)11-5-3-10(14)4-6-11)7-22-13(8)24(20,21)16-15-9(2)17/h3-7,16H,1-2H3,(H,15,17) |
| InChIKey | VIEQAUWOUPFGMC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|