C11H15ClN2O5S2 — CID 146673602
2-(4-chlorophenyl)sulfonyl-N'-propylsulfonylacetohydrazide (PubChem CID 146673602) has the molecular formula C11H15ClN2O5S2 and a molecular weight of 354.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N'-propylsulfonylacetohydrazide.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N'-propylsulfonylacetohydrazide |
|---|---|
| PubChem CID | 146673602 |
| Molecular Formula | C11H15ClN2O5S2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N'-propylsulfonylacetohydrazide |
| SMILES | CCCS(=O)(=O)NNC(=O)CS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H15ClN2O5S2/c1-2-7-21(18,19)14-13-11(15)8-20(16,17)10-5-3-9(12)4-6-10/h3-6,14H,2,7-8H2,1H3,(H,13,15) |
| InChIKey | IOVPJYSHPIQLEJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|