C14H15ClN2O5S4 — CID 2819949
2-[2-(benzenesulfonyl)ethylsulfanyl]-N'-(5-chlorothiophen-2-yl)sulfonylacetohydrazide (PubChem CID 2819949) has the molecular formula C14H15ClN2O5S4 and a molecular weight of 455.00 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)ethylsulfanyl]-N'-(5-chlorothiophen-2-yl)sulfonylacetohydrazide.
| Compound Name | 2-[2-(benzenesulfonyl)ethylsulfanyl]-N'-(5-chlorothiophen-2-yl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 2819949 |
| Molecular Formula | C14H15ClN2O5S4 |
| Molecular Weight | 455.00 g/mol |
| Exact Mass | 453.96 |
| IUPAC Name | 2-[2-(benzenesulfonyl)ethylsulfanyl]-N'-(5-chlorothiophen-2-yl)sulfonylacetohydrazide |
| SMILES | O=C(CSCCS(=O)(=O)c1ccccc1)NNS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H15ClN2O5S4/c15-12-6-7-14(24-12)26(21,22)17-16-13(18)10-23-8-9-25(19,20)11-4-2-1-3-5-11/h1-7,17H,8-10H2,(H,16,18) |
| InChIKey | YFAGIFBFPSPPDI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.00 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|