C10H11ClN2O5S2 — CID 138377017
2-[2-(4-chlorophenyl)sulfonylethenylsulfonyl]acetohydrazide (PubChem CID 138377017) has the molecular formula C10H11ClN2O5S2 and a molecular weight of 338.79 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)sulfonylethenylsulfonyl]acetohydrazide.
| Compound Name | 2-[2-(4-chlorophenyl)sulfonylethenylsulfonyl]acetohydrazide |
|---|---|
| PubChem CID | 138377017 |
| Molecular Formula | C10H11ClN2O5S2 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 2-[2-(4-chlorophenyl)sulfonylethenylsulfonyl]acetohydrazide |
| SMILES | NNC(=O)CS(=O)(=O)C=CS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H11ClN2O5S2/c11-8-1-3-9(4-2-8)20(17,18)6-5-19(15,16)7-10(14)13-12/h1-6H,7,12H2,(H,13,14) |
| InChIKey | CPKNTPWAULJVAE-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|