C14H12Cl2N2O5S2 — CID 146673644
N',2-bis[(4-chlorophenyl)sulfonyl]acetohydrazide (PubChem CID 146673644) has the molecular formula C14H12Cl2N2O5S2 and a molecular weight of 423.30 g/mol. Its IUPAC name is N',2-bis[(4-chlorophenyl)sulfonyl]acetohydrazide.
| Compound Name | N',2-bis[(4-chlorophenyl)sulfonyl]acetohydrazide |
|---|---|
| PubChem CID | 146673644 |
| Molecular Formula | C14H12Cl2N2O5S2 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 421.96 |
| IUPAC Name | N',2-bis[(4-chlorophenyl)sulfonyl]acetohydrazide |
| SMILES | O=C(CS(=O)(=O)c1ccc(Cl)cc1)NNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H12Cl2N2O5S2/c15-10-1-5-12(6-2-10)24(20,21)9-14(19)17-18-25(22,23)13-7-3-11(16)4-8-13/h1-8,18H,9H2,(H,17,19) |
| InChIKey | LERFFOGKMFGCGO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|