C21H27N4O4S+ — CID 10183459
1-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-N'-methylsulfonylpyridin-1-ium-3-carbohydrazide (PubChem CID 10183459) has the molecular formula C21H27N4O4S+ and a molecular weight of 431.54 g/mol. Its IUPAC name is 1-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-N'-methylsulfonylpyridin-1-ium-3-carbohydrazide.
| Compound Name | 1-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-N'-methylsulfonylpyridin-1-ium-3-carbohydrazide |
|---|---|
| PubChem CID | 10183459 |
| Molecular Formula | C21H27N4O4S+ |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 1-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-N'-methylsulfonylpyridin-1-ium-3-carbohydrazide |
| SMILES | CS(=O)(=O)NNC(=O)c1ccc[n+](CC(=O)N2CCC(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H26N4O4S/c1-30(28,29)23-22-21(27)19-8-5-11-24(15-19)16-20(26)25-12-9-18(10-13-25)14-17-6-3-2-4-7-17/h2-8,11,15,18,23H,9-10,12-14,16H2,1H3/p+1 |
| InChIKey | MXQIROOUJWBGKZ-UHFFFAOYSA-O |
| XLogP | 0.65 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|