C23H29N2O+ — CID 8877144
1-(4-benzylpiperidin-1-yl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)ethanone (PubChem CID 8877144) has the molecular formula C23H29N2O+ and a molecular weight of 349.50 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)ethanone.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)ethanone |
|---|---|
| PubChem CID | 8877144 |
| Molecular Formula | C23H29N2O+ |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)ethanone |
| SMILES | O=C(C[n+]1ccc2c(c1)CCCC2)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H29N2O/c26-23(18-24-13-12-21-8-4-5-9-22(21)17-24)25-14-10-20(11-15-25)16-19-6-2-1-3-7-19/h1-3,6-7,12-13,17,20H,4-5,8-11,14-16,18H2/q+1 |
| InChIKey | KRBWHBKHYLQVHI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|