C28H42N4O3 — CID 10184490
1-[1-[2-hydroxy-3-[2-hydroxyethyl(pentyl)amino]propyl]piperidin-4-yl]-3-(2-phenylphenyl)urea (PubChem CID 10184490) has the molecular formula C28H42N4O3 and a molecular weight of 482.67 g/mol. Its IUPAC name is 1-[1-[2-hydroxy-3-[2-hydroxyethyl(pentyl)amino]propyl]piperidin-4-yl]-3-(2-phenylphenyl)urea.
| Compound Name | 1-[1-[2-hydroxy-3-[2-hydroxyethyl(pentyl)amino]propyl]piperidin-4-yl]-3-(2-phenylphenyl)urea |
|---|---|
| PubChem CID | 10184490 |
| Molecular Formula | C28H42N4O3 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.33 |
| IUPAC Name | 1-[1-[2-hydroxy-3-[2-hydroxyethyl(pentyl)amino]propyl]piperidin-4-yl]-3-(2-phenylphenyl)urea |
| SMILES | CCCCCN(CCO)CC(O)CN1CCC(NC(=O)Nc2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C28H42N4O3/c1-2-3-9-16-31(19-20-33)21-25(34)22-32-17-14-24(15-18-32)29-28(35)30-27-13-8-7-12-26(27)23-10-5-4-6-11-23/h4-8,10-13,24-25,33-34H,2-3,9,14-22H2,1H3,(H2,29,30,35) |
| InChIKey | JOIRVHXHFVMFDZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|