C35H44N4O2 — CID 10280903
1-(2-phenylphenyl)-3-[1-[3-(4-phenyl-4-propanoylpiperidin-1-yl)propyl]piperidin-4-yl]urea (PubChem CID 10280903) has the molecular formula C35H44N4O2 and a molecular weight of 552.76 g/mol. Its IUPAC name is 1-(2-phenylphenyl)-3-[1-[3-(4-phenyl-4-propanoylpiperidin-1-yl)propyl]piperidin-4-yl]urea.
| Compound Name | 1-(2-phenylphenyl)-3-[1-[3-(4-phenyl-4-propanoylpiperidin-1-yl)propyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 10280903 |
| Molecular Formula | C35H44N4O2 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | 1-(2-phenylphenyl)-3-[1-[3-(4-phenyl-4-propanoylpiperidin-1-yl)propyl]piperidin-4-yl]urea |
| SMILES | CCC(=O)C1(c2ccccc2)CCN(CCCN2CCC(NC(=O)Nc3ccccc3-c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C35H44N4O2/c1-2-33(40)35(29-14-7-4-8-15-29)20-26-39(27-21-35)23-11-22-38-24-18-30(19-25-38)36-34(41)37-32-17-10-9-16-31(32)28-12-5-3-6-13-28/h3-10,12-17,30H,2,11,18-27H2,1H3,(H2,36,37,41) |
| InChIKey | QEGCPUNWWGUVMP-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |