C36H50N4O4 — CID 11342445
1-[1-[9-[[(2R)-2-hydroxy-2-[4-hydroxy-2-(hydroxymethyl)phenyl]ethyl]amino]nonyl]piperidin-4-yl]-3-(2-phenylphenyl)urea (PubChem CID 11342445) has the molecular formula C36H50N4O4 and a molecular weight of 602.82 g/mol. Its IUPAC name is 1-[1-[9-[[(2R)-2-hydroxy-2-[4-hydroxy-2-(hydroxymethyl)phenyl]ethyl]amino]nonyl]piperidin-4-yl]-3-(2-phenylphenyl)urea.
| Compound Name | 1-[1-[9-[[(2R)-2-hydroxy-2-[4-hydroxy-2-(hydroxymethyl)phenyl]ethyl]amino]nonyl]piperidin-4-yl]-3-(2-phenylphenyl)urea |
|---|---|
| PubChem CID | 11342445 |
| Molecular Formula | C36H50N4O4 |
| Molecular Weight | 602.82 g/mol |
| Exact Mass | 602.38 |
| IUPAC Name | 1-[1-[9-[[(2R)-2-hydroxy-2-[4-hydroxy-2-(hydroxymethyl)phenyl]ethyl]amino]nonyl]piperidin-4-yl]-3-(2-phenylphenyl)urea |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)NC1CCN(CCCCCCCCCNC[C@H](O)c2ccc(O)cc2CO)CC1 |
| InChI | InChI=1S/C36H50N4O4/c41-27-29-25-31(42)17-18-33(29)35(43)26-37-21-11-4-2-1-3-5-12-22-40-23-19-30(20-24-40)38-36(44)39-34-16-10-9-15-32(34)28-13-7-6-8-14-28/h6-10,13-18,25,30,35,37,41-43H,1-5,11-12,19-24,26-27H2,(H2,38,39,44)/t35-/m0/s1 |
| InChIKey | ULNIPNQUDVHEHD-DHUJRADRSA-N |
| XLogP | 6.19 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.82 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|