C23H27Cl3N2O3 — CID 10184650
4-[1-(4-chlorophenyl)ethyl-[3-[[2-(2,6-dichlorophenyl)acetyl]amino]propyl]amino]butanoic acid (PubChem CID 10184650) has the molecular formula C23H27Cl3N2O3 and a molecular weight of 485.84 g/mol. Its IUPAC name is 4-[1-(4-chlorophenyl)ethyl-[3-[[2-(2,6-dichlorophenyl)acetyl]amino]propyl]amino]butanoic acid.
| Compound Name | 4-[1-(4-chlorophenyl)ethyl-[3-[[2-(2,6-dichlorophenyl)acetyl]amino]propyl]amino]butanoic acid |
|---|---|
| PubChem CID | 10184650 |
| Molecular Formula | C23H27Cl3N2O3 |
| Molecular Weight | 485.84 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 4-[1-(4-chlorophenyl)ethyl-[3-[[2-(2,6-dichlorophenyl)acetyl]amino]propyl]amino]butanoic acid |
| SMILES | CC(c1ccc(Cl)cc1)N(CCCNC(=O)Cc1c(Cl)cccc1Cl)CCCC(=O)O |
| InChI | InChI=1S/C23H27Cl3N2O3/c1-16(17-8-10-18(24)11-9-17)28(13-3-7-23(30)31)14-4-12-27-22(29)15-19-20(25)5-2-6-21(19)26/h2,5-6,8-11,16H,3-4,7,12-15H2,1H3,(H,27,29)(H,30,31) |
| InChIKey | HXQZZLFPCFGSLY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.84 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|