C23H26ClF3N2O3 — CID 10183727
4-[1-(4-chlorophenyl)ethyl-[3-[[2-(2,4,6-trifluorophenyl)acetyl]amino]propyl]amino]butanoic acid (PubChem CID 10183727) has the molecular formula C23H26ClF3N2O3 and a molecular weight of 470.92 g/mol. Its IUPAC name is 4-[1-(4-chlorophenyl)ethyl-[3-[[2-(2,4,6-trifluorophenyl)acetyl]amino]propyl]amino]butanoic acid.
| Compound Name | 4-[1-(4-chlorophenyl)ethyl-[3-[[2-(2,4,6-trifluorophenyl)acetyl]amino]propyl]amino]butanoic acid |
|---|---|
| PubChem CID | 10183727 |
| Molecular Formula | C23H26ClF3N2O3 |
| Molecular Weight | 470.92 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 4-[1-(4-chlorophenyl)ethyl-[3-[[2-(2,4,6-trifluorophenyl)acetyl]amino]propyl]amino]butanoic acid |
| SMILES | CC(c1ccc(Cl)cc1)N(CCCNC(=O)Cc1c(F)cc(F)cc1F)CCCC(=O)O |
| InChI | InChI=1S/C23H26ClF3N2O3/c1-15(16-5-7-17(24)8-6-16)29(10-2-4-23(31)32)11-3-9-28-22(30)14-19-20(26)12-18(25)13-21(19)27/h5-8,12-13,15H,2-4,9-11,14H2,1H3,(H,28,30)(H,31,32) |
| InChIKey | WBERNFNXUKQROF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.92 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|