C19H20ClFN2O3 — CID 122022306
4-[[[(4-chlorophenyl)-(4-fluorophenyl)methyl]-methylcarbamoyl]amino]butanoic acid (PubChem CID 122022306) has the molecular formula C19H20ClFN2O3 and a molecular weight of 378.83 g/mol. Its IUPAC name is 4-[[[(4-chlorophenyl)-(4-fluorophenyl)methyl]-methylcarbamoyl]amino]butanoic acid.
| Compound Name | 4-[[[(4-chlorophenyl)-(4-fluorophenyl)methyl]-methylcarbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122022306 |
| Molecular Formula | C19H20ClFN2O3 |
| Molecular Weight | 378.83 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 4-[[[(4-chlorophenyl)-(4-fluorophenyl)methyl]-methylcarbamoyl]amino]butanoic acid |
| SMILES | CN(C(=O)NCCCC(=O)O)C(c1ccc(F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClFN2O3/c1-23(19(26)22-12-2-3-17(24)25)18(13-4-8-15(20)9-5-13)14-6-10-16(21)11-7-14/h4-11,18H,2-3,12H2,1H3,(H,22,26)(H,24,25) |
| InChIKey | SCZWJJLWIRPGJN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.83 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|