C28H23N3O6 — CID 10185222
[2-(7-methoxy-12,14-dioxo-3,13,16-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(23),2(10),4(9),5,7,11(15),17,19,21-nonaen-3-yl)-2-oxoethyl] 2,2-dimethylpropanoate (PubChem CID 10185222) has the molecular formula C28H23N3O6 and a molecular weight of 497.51 g/mol. Its IUPAC name is [2-(7-methoxy-12,14-dioxo-3,13,16-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(23),2(10),4(9),5,7,11(15),17,19,21-nonaen-3-yl)-2-oxoethyl] 2,2-dimethylpropanoate.
| Compound Name | [2-(7-methoxy-12,14-dioxo-3,13,16-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(23),2(10),4(9),5,7,11(15),17,19,21-nonaen-3-yl)-2-oxoethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10185222 |
| Molecular Formula | C28H23N3O6 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | [2-(7-methoxy-12,14-dioxo-3,13,16-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(23),2(10),4(9),5,7,11(15),17,19,21-nonaen-3-yl)-2-oxoethyl] 2,2-dimethylpropanoate |
| SMILES | COc1ccc2c(c1)c1c3c(n4c5ccccc5cc4c1n2C(=O)COC(=O)C(C)(C)C)C(=O)NC3=O |
| InChI | InChI=1S/C28H23N3O6/c1-28(2,3)27(35)37-13-20(32)31-18-10-9-15(36-4)12-16(18)21-22-24(26(34)29-25(22)33)30-17-8-6-5-7-14(17)11-19(30)23(21)31/h5-12H,13H2,1-4H3,(H,29,33,34) |
| InChIKey | IJYRGAJODSXSCC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|