C28H24N4O6 — CID 10207808
tert-butyl N-[2-(7-methoxy-12,14-dioxo-3,13,16-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(23),2(10),4(9),5,7,11(15),17,19,21-nonaen-3-yl)-2-oxoethyl]carbamate (PubChem CID 10207808) has the molecular formula C28H24N4O6 and a molecular weight of 512.52 g/mol. Its IUPAC name is tert-butyl N-[2-(7-methoxy-12,14-dioxo-3,13,16-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(23),2(10),4(9),5,7,11(15),17,19,21-nonaen-3-yl)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-(7-methoxy-12,14-dioxo-3,13,16-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(23),2(10),4(9),5,7,11(15),17,19,21-nonaen-3-yl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 10207808 |
| Molecular Formula | C28H24N4O6 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | tert-butyl N-[2-(7-methoxy-12,14-dioxo-3,13,16-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(23),2(10),4(9),5,7,11(15),17,19,21-nonaen-3-yl)-2-oxoethyl]carbamate |
| SMILES | COc1ccc2c(c1)c1c3c(n4c5ccccc5cc4c1n2C(=O)CNC(=O)OC(C)(C)C)C(=O)NC3=O |
| InChI | InChI=1S/C28H24N4O6/c1-28(2,3)38-27(36)29-13-20(33)32-18-10-9-15(37-4)12-16(18)21-22-24(26(35)30-25(22)34)31-17-8-6-5-7-14(17)11-19(31)23(21)32/h5-12H,13H2,1-4H3,(H,29,36)(H,30,34,35) |
| InChIKey | QVYHSSHHTWFSBA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|